Introduction：Basic information about CAS 646055-62-1|1-Benzyl-1,7-diaza-spiro[4.4]nonane-7-carboxylic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Benzyl-1,7-diaza-spiro[4.4]nonane-7-carboxylic acid tert-butyl ester |
|---|
| CAS Number | 646055-62-1 | Molecular Weight | 316.43800 |
|---|
| Density | 1.121g/cm3 | Boiling Point | 413.718ºC at 760 mmHg |
|---|
| Molecular Formula | C19H28N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.01ºC |
|---|
Names
| Name | 2-Methyl-2-propanyl 1-benzyl-1,7-diazaspiro[4.4]nonane-7-carboxyl ate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.121g/cm3 |
|---|
| Boiling Point | 413.718ºC at 760 mmHg |
|---|
| Molecular Formula | C19H28N2O2 |
|---|
| Molecular Weight | 316.43800 |
|---|
| Flash Point | 204.01ºC |
|---|
| Exact Mass | 316.21500 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 3.53780 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | LECMSITUHGZUDO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN2Cc2ccccc2)C1 |
|---|
Synonyms
| Hexanoic acid,6-amino-,1,1-dimethylethyl ester |
| t-butyl 6-aminohexanoate |
| 1,1-dimethylethyl 6-amino-caproate |
| tert-butyl 6-aminocaproate |
