Introduction：Basic information about CAS 923009-90-9|2-Methyl-2-propanyl 3-ethyl-3-methyl-1-oxo-2-oxa-7-azaspiro[4.5]d ecane-7-carboxylat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-2-propanyl 3-ethyl-3-methyl-1-oxo-2-oxa-7-azaspiro[4.5]d ecane-7-carboxylate |
|---|
| CAS Number | 923009-90-9 | Molecular Weight | 297.39000 |
|---|
| Density | 1.1g/cm3 | Boiling Point | 418.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H27NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207ºC |
|---|
Names
| Name | 2-Methyl-2-propanyl 3-ethyl-3-methyl-1-oxo-2-oxa-7-azaspiro[4.5]d ecane-7-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.1g/cm3 |
|---|
| Boiling Point | 418.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H27NO4 |
|---|
| Molecular Weight | 297.39000 |
|---|
| Flash Point | 207ºC |
|---|
| Exact Mass | 297.19400 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 3.05720 |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | YNKRHXKJBFFXNA-UHFFFAOYSA-N |
|---|
| SMILES | CCC1(C)CC2(CCCN(C(=O)OC(C)(C)C)C2)C(=O)O1 |
|---|
