Introduction：Basic information about CAS 924871-61-4|3-Bromo-8-(phenylsulfonyl)-1-oxa-8-azaspiro[4.5]decane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromo-8-(phenylsulfonyl)-1-oxa-8-azaspiro[4.5]decane |
|---|
| CAS Number | 924871-61-4 | Molecular Weight | 360.26700 |
|---|
| Density | 1.563g/cm3 | Boiling Point | 485.783ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18BrNO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.593ºC |
|---|
Names
| Name | 3-Bromo-8-(phenylsulfonyl)-1-oxa-8-azaspiro[4.5]decane |
|---|
Chemical & Physical Properties
| Density | 1.563g/cm3 |
|---|
| Boiling Point | 485.783ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18BrNO3S |
|---|
| Molecular Weight | 360.26700 |
|---|
| Flash Point | 247.593ºC |
|---|
| Exact Mass | 359.01900 |
|---|
| PSA | 54.99000 |
|---|
| LogP | 3.41240 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | OVARABZNHWXTRC-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CC1)CC(Br)CO2 |
|---|
