Introduction:Basic information about CAS 928034-34-8|8-Benzyl 1-(2-methyl-2-propanyl) 1,8-diazaspiro[4.5]decane-1,8-di carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Benzyl 1-(2-methyl-2-propanyl) 1,8-diazaspiro[4.5]decane-1,8-di carboxylate |
|---|
| CAS Number | 928034-34-8 | Molecular Weight | 374.47400 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H30N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.4ºC |
|---|
Names
| Name | 8-Benzyl 1-(2-methyl-2-propanyl) 1,8-diazaspiro[4.5]decane-1,8-di carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H30N2O4 |
|---|
| Molecular Weight | 374.47400 |
|---|
| Flash Point | 253.4ºC |
|---|
| Exact Mass | 374.22100 |
|---|
| PSA | 59.08000 |
|---|
| LogP | 4.06450 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | JQRKXLAPRZHMRT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCN(C(=O)OCc1ccccc1)CC2 |
|---|
Synonyms
| 8-benzoyloxy-2-methoxy-7,8,9,10-tetrahydro-5H-phenanthridin-6-one |
| 2-methoxy-6-oxo-5,6,7,8,9,10-hexahydrophenanthridin-8-yl benzoate |