Introduction：Basic information about CAS 34715-60-1|2-(p-isobutylphenyl)propionyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(p-isobutylphenyl)propionyl chloride |
|---|
| CAS Number | 34715-60-1 | Molecular Weight | 224.72600 |
|---|
| Density | 1.049g/cm3 | Boiling Point | 295ºC at 760mmHg |
|---|
| Molecular Formula | C13H17ClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.1ºC |
|---|
Names
| Name | 2-[4-(2-methylpropyl)phenyl]propanoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.049g/cm3 |
|---|
| Boiling Point | 295ºC at 760mmHg |
|---|
| Molecular Formula | C13H17ClO |
|---|
| Molecular Weight | 224.72600 |
|---|
| Flash Point | 134.1ºC |
|---|
| Exact Mass | 224.09700 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.75400 |
|---|
| Index of Refraction | 1.51 |
|---|
| InChIKey | QXVRLFIKHYCFJS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Cc1ccc(C(C)C(=O)Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 252-165-5 |
| OR0555 |
| 2-[4-(Isobutyl)phenyl]propionyl chloride |
| 2-(p-isobutylphenyl)propionic acid chloride |
| 2-(4-isobutylphenyl)-propionic acid chloride |
| 2-(4-Isobutylphenyl)propanoyl chloride |
| 2-(p-Isobutylphenyl)propionyl chloride |
