Introduction：Basic information about CAS 63467-05-0|2-[[2-methyl-4-[(4-nitrophenyl)azo]phenyl]amino]ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[2-methyl-4-[(4-nitrophenyl)azo]phenyl]amino]ethanol |
|---|
| CAS Number | 63467-05-0 | Molecular Weight | 300.31300 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 546.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.4ºC |
|---|
Names
| Name | 2-[2-methyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 546.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N4O3 |
|---|
| Molecular Weight | 300.31300 |
|---|
| Flash Point | 284.4ºC |
|---|
| Exact Mass | 300.12200 |
|---|
| PSA | 102.80000 |
|---|
| LogP | 4.31900 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | XPNPVCPVYKXTJO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N=Nc2ccc([N+](=O)[O-])cc2)ccc1NCCO |
|---|
Synonyms
| 2-((2-Methyl-4-((4-nitrophenyl)azo)phenyl)amino)ethanol |
| 2-(2-Methyl-4-((p-nitrophenyl)azo)anilino)ethanol |
| EINECS 264-217-4 |
