Introduction：Basic information about CAS 342002-80-6|3-Isopropoxycarbonylphenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Isopropoxycarbonylphenylboronic acid |
|---|
| CAS Number | 342002-80-6 | Molecular Weight | 208.019 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 370.7±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13BO4 | Melting Point | 153-154 |
|---|
| MSDS | / | Flash Point | 178.0±28.4 °C |
|---|
Names
| Name | (3-propan-2-yloxycarbonylphenyl)boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 370.7±44.0 °C at 760 mmHg |
|---|
| Melting Point | 153-154 |
|---|
| Molecular Formula | C10H13BO4 |
|---|
| Molecular Weight | 208.019 |
|---|
| Flash Point | 178.0±28.4 °C |
|---|
| Exact Mass | 208.090683 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.45 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.520 |
|---|
| InChIKey | HXVODQWMURGQMP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OC(=O)c1cccc(B(O)O)c1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26-S16 |
|---|
Synonyms
| 3-(Isopropoxycarbonyl)benzeneboronic acid |
| MFCD02093047 |
| [3-(Isopropoxycarbonyl)phenyl]boronic acid |
| Benzoic acid, 3-borono-, 1-methylethyl ester |
| (3-(Isopropoxycarbonyl)phenyl)boronic acid |
| 3-Isopropoxycarbonylphenylboronic acid |
