Introduction:Basic information about CAS 34443-12-4|tert-Butylperoxy-2-ethylhexylcarbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butylperoxy-2-ethylhexylcarbonate |
|---|
| CAS Number | 34443-12-4 | Molecular Weight | 246.34300 |
|---|
| Density | 0.927 | Boiling Point | 271.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H26O4 | Melting Point | -50ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 214 °F |
|---|
| Symbol | GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | tert-Butylperoxy 2-ethylhexyl carbonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.927 |
|---|
| Boiling Point | 271.8ºC at 760 mmHg |
|---|
| Melting Point | -50ºC |
|---|
| Molecular Formula | C13H26O4 |
|---|
| Molecular Weight | 246.34300 |
|---|
| Flash Point | 214 °F |
|---|
| Exact Mass | 246.18300 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 4.08610 |
|---|
| Index of Refraction | 1.428 |
|---|
| InChIKey | BRQMAAFGEXNUOL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)OOC(C)(C)C |
|---|
| Storage condition | Refrigerator (+4°C) |
|---|
Safety Information
| Symbol | GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H242-H312-H315 |
|---|
| Precautionary Statements | P220-P280-P410-P412 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | O:Oxidizingagent;Xn:Harmful; |
|---|
| Risk Phrases | R8;R21;R38 |
|---|
| Safety Phrases | S7-S17-S36/37/39 |
|---|
| RIDADR | UN 3105 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| terbutylperoxy-2-ethylhexyl carbonate |
| Trigonox 117 |
| MFCD01863715 |
| tert-butyl peroxy-2-ethylhexylcarbonate |
| LUPEROX TBEC |
| t-Butyl peroxy 2-ethylhexyl monocarbonate |
| EINECS 252-029-5 |