Introduction：Basic information about CAS 6312-50-1|N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide |
|---|
| CAS Number | 6312-50-1 | Molecular Weight | 326.18900 |
|---|
| Density | 1.454 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H16BrN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.454 g/cm3 |
|---|
| Molecular Formula | C13H16BrN3O2 |
|---|
| Molecular Weight | 326.18900 |
|---|
| Exact Mass | 325.04300 |
|---|
| PSA | 52.65000 |
|---|
| LogP | 1.81300 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | LUWIKRVXBFEEHB-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(C(=O)NC(=O)c2ccc(Br)cc2)CC1 |
|---|
