Introduction：Basic information about CAS 7791-71-1|5'-O-Tritylthymidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5'-O-Tritylthymidine |
|---|
| CAS Number | 7791-71-1 | Molecular Weight | 484.543 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C29H28N2O5 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 5'-O-Tritylthymidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C29H28N2O5 |
|---|
| Molecular Weight | 484.543 |
|---|
| Exact Mass | 484.199829 |
|---|
| PSA | 93.55000 |
|---|
| LogP | 5.05 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | FZDHVUVGQXVYOP-JIMJEQGWSA-N |
|---|
| SMILES | Cc1cn(C2CC(O)C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)[nH]c1=O |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3.0 |
|---|
Synonyms
| 5'-O-Triphenylmethylthymidine |
| 1-(2-Deoxy-5-O-tritylpentofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione |
| 5'-O-trityl thymidine |
| 5'-O-tritythymidine |
| 2,4(1H,3H)-Pyrimidinedione, 1-[2-deoxy-5-O-(triphenylmethyl)pentofuranosyl]-5-methyl- |
| 5'-O-Tr-dThd |
| Trt-dT |
| 1-(2-deoxy-5-O-tritylpentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione |
| 5-Methyl-5'-O-trityl-2'-deoxyuridine |
