Introduction：Basic information about CAS 79559-61-8|5-Hydroxy-7-(4'-hydroxy-3'-methoxyphenyl)-1-phenyl-3-heptanone (DHPA), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Hydroxy-7-(4'-hydroxy-3'-methoxyphenyl)-1-phenyl-3-heptanone (DHPA) |
|---|
| CAS Number | 79559-61-8 | Molecular Weight | 328.402 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 552.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H24O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.1±23.6 °C |
|---|
Names
| Name | 5-hydroxy-7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-3-heptanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 552.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H24O4 |
|---|
| Molecular Weight | 328.402 |
|---|
| Flash Point | 196.1±23.6 °C |
|---|
| Exact Mass | 328.167450 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.52 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | JHJPDDBIHSFERA-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(CCC(O)CC(=O)CCc2ccccc2)ccc1O |
|---|
Synonyms
| 5-Hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenylheptan-3-one |
| 5-Hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl-3-heptanone |
| 3-Heptanone, 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl- |
| 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl-3- heptanone |
| 5-hydroxy-6-tert.-butyl-1,1-pentamethylene-3,3-dimethyl-indane |
