Introduction:Basic information about CAS 34523-28-9|dansyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dansyl fluoride |
|---|
| CAS Number | 34523-28-9 | Molecular Weight | 253.29300 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 352.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H12FNO2S | Melting Point | 52 °C |
|---|
| MSDS | / | Flash Point | 167.2ºC |
|---|
Names
| Name | 5-(dimethylamino)naphthalene-1-sulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 352.8ºC at 760mmHg |
|---|
| Melting Point | 52 °C |
|---|
| Molecular Formula | C12H12FNO2S |
|---|
| Molecular Weight | 253.29300 |
|---|
| Flash Point | 167.2ºC |
|---|
| Exact Mass | 253.05700 |
|---|
| PSA | 45.76000 |
|---|
| LogP | 3.64480 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | JMHHECQPPFEVMU-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1cccc2c(S(=O)(=O)F)cccc12 |
|---|
| Storage condition | ?20°C |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34:Causes burns. |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2921199090 |
|---|
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-(Dimethylamino)-1-naphthalenesulfonyl fluoride,DNSF |
| 5-Dimethylamino-1-naphthalenesulfonyl fluoride |
| DNSF [DANSYL Fluoride] |
| 5-(Dimethylamino)-1-naphthalenesulfonyl fluoride DNSF |
| 5-Dimethylaminonaphthalin-1-sulfonylfluorid |
| EINECS 252-071-4 |
| 5-dimethylaminonaphthalene-1-sulfonylfluoride |
| MFCD00042702 |
| DNSF |
| 5-Dimethylaminonaphthalene-1-sulfonyl Fluoride |
| dansylfluoride |
| 5-Dimethylamino-1-naphthalinsulfonylfluorid |