Introduction：Basic information about CAS 33685-60-8|9,10-Dinitroanthracene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Dinitroanthracene |
|---|
| CAS Number | 33685-60-8 | Molecular Weight | 268.224 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 464.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.4±18.7 °C |
|---|
Names
| Name | 9,10-dinitroanthracene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 464.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8N2O4 |
|---|
| Molecular Weight | 268.224 |
|---|
| Flash Point | 234.4±18.7 °C |
|---|
| Exact Mass | 268.048401 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.81 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.766 |
|---|
| InChIKey | XYPMAZCBFKBIFK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1c2ccccc2c([N+](=O)[O-])c2ccccc12 |
|---|
Synonyms
| Dinitro-9,10-anthracen |
| Anthracene,9,10-dinitro |
| 9,10-Dinitro-anthracen |
| 9,10-Dinitroanthracene |
| 9,10-Dinitro-anthracene |
| Anthracene, 9,10-dinitro- |
