Introduction：Basic information about CAS 18119-31-8|Carbonic acid 5-chloro-8-quinolyl ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbonic acid 5-chloro-8-quinolyl ethyl ester |
|---|
| CAS Number | 18119-31-8 | Molecular Weight | 251.66600 |
|---|
| Density | 1.33 | Boiling Point | / |
|---|
| Molecular Formula | C12H10ClNO3 | Melting Point | 79.5-80.5ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Carbonic acid 5-chloro-8-quinolyl ethyl ester |
|---|
Chemical & Physical Properties
| Density | 1.33 |
|---|
| Melting Point | 79.5-80.5ºC |
|---|
| Molecular Formula | C12H10ClNO3 |
|---|
| Molecular Weight | 251.66600 |
|---|
| Exact Mass | 251.03500 |
|---|
| PSA | 48.42000 |
|---|
| LogP | 3.42350 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | AMJOAKAXBLLGKJ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Oc1ccc(Cl)c2cccnc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
