Introduction：Basic information about CAS 33742-70-0|2-Methylamino-3-nitro-6-chloropyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methylamino-3-nitro-6-chloropyridine |
|---|
| CAS Number | 33742-70-0 | Molecular Weight | 187.58400 |
|---|
| Density | 1.489 | Boiling Point | 330ºC |
|---|
| Molecular Formula | C6H6ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153ºC |
|---|
Names
| Name | 6-chloro-N-methyl-3-nitropyridin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.489 |
|---|
| Boiling Point | 330ºC |
|---|
| Molecular Formula | C6H6ClN3O2 |
|---|
| Molecular Weight | 187.58400 |
|---|
| Flash Point | 153ºC |
|---|
| Exact Mass | 187.01500 |
|---|
| PSA | 70.74000 |
|---|
| LogP | 2.28110 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | XBUWSEJQFZDJAZ-UHFFFAOYSA-N |
|---|
| SMILES | CNc1nc(Cl)ccc1[N+](=O)[O-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(N-methylamino)-3-nitro-6-chloropyridine |
| 6-Chloro-N-methyl-3-nitropyridin-2-amine |
| 2-Methylamino-3-nitro-6-chlor-pyridin |
| 2-METHYLAMINO-3-NITRO-6-CHLOROPYRIDINE |
| 6-chloro-2-methylamino-3-nitro-pyridine |
| (6-chloro-3-nitro-pyridin-2-yl)-methyl-amine |
| 6-Chloro-2-(N-methylamino)-3-nitropyridine |
