Introduction:Basic information about CAS 18530-30-8|(+)-BETA-PINENEOXIDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-BETA-PINENEOXIDE |
|---|
| CAS Number | 18530-30-8 | Molecular Weight | 196.24300 |
|---|
| Density | 1.174 g/cm3 | Boiling Point | 317.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (+)-camphorcarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.174 g/cm3 |
|---|
| Boiling Point | 317.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16O3 |
|---|
| Molecular Weight | 196.24300 |
|---|
| Exact Mass | 196.11000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 1.71240 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.516 |
|---|
| InChIKey | XNMVAVGXJZFTEH-BUYFANAVSA-N |
|---|
| SMILES | CC12CCC(C(C(=O)O)C1=O)C2(C)C |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Camphercarbonsaeure |
| bismuth tris(2-oxobornane-3-carboxylate) |
| endo-D-(+)-camphoric acid |
| (+)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-endo-2-carboxylic acid |
| d-Camphocarboxylic acid |
| Einecs 242-404-1 |
| Campher-3-carboxylsaeure |