Introduction：Basic information about CAS 82495-75-8|2-(trimethylsilyl)ethoxymethyltriphenylphosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(trimethylsilyl)ethoxymethyltriphenylphosphonium chloride |
|---|
| CAS Number | 82495-75-8 | Molecular Weight | 429.007 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H30ClOPSi | Melting Point | 145-149 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | triphenyl(2-trimethylsilylethoxymethyl)phosphanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 145-149 °C(lit.) |
|---|
| Molecular Formula | C24H30ClOPSi |
|---|
| Molecular Weight | 429.007 |
|---|
| Exact Mass | 428.149200 |
|---|
| PSA | 22.82000 |
|---|
| LogP | 2.29680 |
|---|
| InChIKey | NEUMNYXEDIPGJD-UHFFFAOYSA-M |
|---|
| SMILES | C[Si](C)(C)CCOC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Triphenyl{[2-(trimethylsilyl)ethoxy]methyl}phosphonium chloride |
| Phosphonium, triphenyl[[2-(trimethylsilyl)ethoxy]methyl]-, chloride (1:1) |
| SEM-triphenylphosphonium chloride |
| MFCD00043159 |
