Introduction:Basic information about CAS 79218-87-4|methyl 3,4-di-o-benzyl-a-d-mannopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3,4-di-o-benzyl-a-d-mannopyranoside |
|---|
| CAS Number | 79218-87-4 | Molecular Weight | 374.42800 |
|---|
| Density | 1.245g/cm3 | Boiling Point | 537.057ºC at 760 mmHg |
|---|
| Molecular Formula | C21H26O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278.602ºC |
|---|
Names
| Name | methyl 3,4-di-o-benzyl-a-d-mannopyranoside |
|---|
Chemical & Physical Properties
| Density | 1.245g/cm3 |
|---|
| Boiling Point | 537.057ºC at 760 mmHg |
|---|
| Molecular Formula | C21H26O6 |
|---|
| Molecular Weight | 374.42800 |
|---|
| Flash Point | 278.602ºC |
|---|
| Exact Mass | 374.17300 |
|---|
| PSA | 77.38000 |
|---|
| LogP | 1.88170 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | VDXOCUMLSFQTRW-UHFFFAOYSA-N |
|---|
| SMILES | COC1OC(CO)C(OCc2ccccc2)C(OCc2ccccc2)C1O |
|---|