Introduction:Basic information about CAS 18158-43-5|9H-Fluoren-9-one,2-(dimethylamino)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Fluoren-9-one,2-(dimethylamino)- |
|---|
| CAS Number | 18158-43-5 | Molecular Weight | 223.27000 |
|---|
| Density | 1.221g/cm3 | Boiling Point | 407.3ºC at 760mmHg |
|---|
| Molecular Formula | C15H13NO | Melting Point | 162-166ºC(lit.) |
|---|
| MSDS | Chinese | Flash Point | 169ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(dimethylamino)fluoren-9-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.221g/cm3 |
|---|
| Boiling Point | 407.3ºC at 760mmHg |
|---|
| Melting Point | 162-166ºC(lit.) |
|---|
| Molecular Formula | C15H13NO |
|---|
| Molecular Weight | 223.27000 |
|---|
| Flash Point | 169ºC |
|---|
| Exact Mass | 223.10000 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 2.96400 |
|---|
| Vapour Pressure | 7.62E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | XSDSTTHDKZZVJZ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2c(c1)C(=O)c1ccccc1-2 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Dimethylamino-fluoren-9-on |
| 2-Dimethylamino-9-oxo-fluoren |
| 2-(Dimethylamino)fluorenone |
| 2-(dimethylamino)-9h-fluoren-9-one |
| 2-(Dimethylamino)-9-fluorenone |
| 2-N,N-dimethylamino-fluorenone |
| 2-dimethylamino-fluoren-9-one |
| MFCD00001154 |