Introduction:Basic information about CAS 5847-59-6|2-Bromo-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-4-nitrophenol |
|---|
| CAS Number | 5847-59-6 | Molecular Weight | 218.005 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 298.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4BrNO3 | Melting Point | 111-115ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 134.1±23.2 °C |
|---|
| Symbol | GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | 2-Bromo-4-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 298.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 111-115ºC |
|---|
| Molecular Formula | C6H4BrNO3 |
|---|
| Molecular Weight | 218.005 |
|---|
| Flash Point | 134.1±23.2 °C |
|---|
| Exact Mass | 216.937454 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.36 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | DCIPFSYBGTWYCR-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(O)c(Br)c1 |
|---|
Safety Information
| Symbol | GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H400 |
|---|
| Precautionary Statements | P273 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 22-50 |
|---|
| Safety Phrases | 61 |
|---|
| RIDADR | UN3077 9 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Phenol, 2-bromo-4-nitro- |
| 2-bromo-4-nitro-phenol |
| 2-Brom-4-nitro-1-hydroxy-benzol |
| T-1,E-16(P) |
| 2-Brom-4-nitro-phenol |
| Phenol,2-bromo-4-nitro |
| 2-Bromo-4-nitrophenol |
| 3-bromo-4-hydroxynitrobenzene |
| MFCD06656567 |