Introduction：Basic information about CAS 7153-86-8|4-Chloro-2-nitrophenylurea, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-2-nitrophenylurea |
|---|
| CAS Number | 7153-86-8 | Molecular Weight | 215.59400 |
|---|
| Density | 1.615 | Boiling Point | 340ºC |
|---|
| Molecular Formula | C7H6ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160ºC |
|---|
Names
| Name | 4-Chloro-2-nitrophenylurea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.615 |
|---|
| Boiling Point | 340ºC |
|---|
| Molecular Formula | C7H6ClN3O3 |
|---|
| Molecular Weight | 215.59400 |
|---|
| Flash Point | 160ºC |
|---|
| Exact Mass | 215.01000 |
|---|
| PSA | 100.94000 |
|---|
| LogP | 3.03530 |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | YJXHCXUVZSLKMC-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
|---|
Synonyms
| N-(4-Chloro-3-nitrophenyl)-urea |
| (4-Chlor-2-nitro-phenyl)-harnstoff |
| (4-chloro-2-nitro-phenyl)-urea |
