Introduction：Basic information about CAS 33528-13-1|n-benzyl-n-nitroso-p-toluenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-benzyl-n-nitroso-p-toluenesulfonamide |
|---|
| CAS Number | 33528-13-1 | Molecular Weight | 290.33800 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14N2O3S | Melting Point | 85ºC |
|---|
| MSDS | / | Flash Point | 219.1ºC |
|---|
Names
| Name | N-benzyl-4-methyl-N-nitrosobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Melting Point | 85ºC |
|---|
| Molecular Formula | C14H14N2O3S |
|---|
| Molecular Weight | 290.33800 |
|---|
| Flash Point | 219.1ºC |
|---|
| Exact Mass | 290.07300 |
|---|
| PSA | 75.19000 |
|---|
| LogP | 3.94810 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | ZXELPGWSCCGNDS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)N=O)cc1 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| MFCD00216617 |
| N-benzyl-N-nitroso-4-toluenesulfonamide |
| N-nitroso-N-benzyl-p-toluenesulphonamide |
| N-Benzyl-4-methyl-N-nitrosobenzenesulfonamide |
| N-benzyl-N-nitrosotosylamide |
| N-Benzyl-N-nitroso-p-toluenesulfonamide |
| N-benzyl-N-nitroso-toluene-4-sulfonamide |
| N-Benzyl-N-nitroso-toluol-4-sulfonamid |
