Introduction：Basic information about CAS 5805-42-5|2-ethyl-5-nitro-3H-benzoimidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ethyl-5-nitro-3H-benzoimidazole |
|---|
| CAS Number | 5805-42-5 | Molecular Weight | 191.18700 |
|---|
| Density | 1.368g/cm3 | Boiling Point | 440.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H9N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.1ºC |
|---|
Names
| Name | 2-ethyl-6-nitro-1H-benzimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.368g/cm3 |
|---|
| Boiling Point | 440.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H9N3O2 |
|---|
| Molecular Weight | 191.18700 |
|---|
| Flash Point | 220.1ºC |
|---|
| Exact Mass | 191.06900 |
|---|
| PSA | 74.50000 |
|---|
| LogP | 2.55670 |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | AAJAEEPAUQTYFB-UHFFFAOYSA-N |
|---|
| SMILES | CCc1nc2ccc([N+](=O)[O-])cc2[nH]1 |
|---|
Synonyms
| 2-ethyl-5-nitro-1H-benzimidazole |
| 5-nitro-2-ethylbenzimidazole |
| 2-ethyl-5-nitro-3H-benzoimidazole |
| 2-ethyl-5-nitrobenzimidazole |
