Introduction：Basic information about CAS 778-09-6|N-(3-methyl-1-adamantyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-methyl-1-adamantyl)acetamide |
|---|
| CAS Number | 778-09-6 | Molecular Weight | 207.31200 |
|---|
| Density | 1.06g/cm3 | Boiling Point | 349.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H21NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.5ºC |
|---|
Names
| Name | N-(3-methyl-1-adamantyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.06g/cm3 |
|---|
| Boiling Point | 349.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H21NO |
|---|
| Molecular Weight | 207.31200 |
|---|
| Flash Point | 209.5ºC |
|---|
| Exact Mass | 207.16200 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 2.87230 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | SANVSQCVSVDXSG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC12CC3CC(CC(C)(C3)C1)C2 |
|---|
Synonyms
| 1-acetylamino-3-methyladamantane |
| 1-N-acetylamino-3-methyladamantane |
| 1-methyl-3-acetylaminoadamantane |
| N-acetyl-3-methyl-1-aminoadamantane |
| N-acetyl-1-amino-3-methyladamantane |
