Introduction：Basic information about CAS 4760-54-7|Acetonitrile,(p-aminophenyl)(p-methoxyphenyl)- (7CI,8CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetonitrile,(p-aminophenyl)(p-methoxyphenyl)- (7CI,8CI) |
|---|
| CAS Number | 4760-54-7 | Molecular Weight | 238.28400 |
|---|
| Density | 1.158g/cm3 | Boiling Point | 427ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212ºC |
|---|
Names
| Name | 2-(4-aminophenyl)-2-(4-methoxyphenyl)acetonitrile |
|---|
Chemical & Physical Properties
| Density | 1.158g/cm3 |
|---|
| Boiling Point | 427ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O |
|---|
| Molecular Weight | 238.28400 |
|---|
| Flash Point | 212ºC |
|---|
| Exact Mass | 238.11100 |
|---|
| PSA | 59.04000 |
|---|
| LogP | 3.51408 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | ZBOSPCBMOVMROW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(C#N)c2ccc(N)cc2)cc1 |
|---|
