Introduction：Basic information about CAS 62470-46-6|4-Vinylphenyl β-D-glucopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Vinylphenyl β-D-glucopyranoside |
|---|
| CAS Number | 62470-46-6 | Molecular Weight | 282.289 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 527.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.5±30.1 °C |
|---|
Names
| Name | 4-Vinylphenyl β-D-glucopyranoside |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 527.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O6 |
|---|
| Molecular Weight | 282.289 |
|---|
| Flash Point | 272.5±30.1 °C |
|---|
| Exact Mass | 282.110352 |
|---|
| PSA | 99.38000 |
|---|
| LogP | -0.19 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | UBOROQNWLSDLJF-RKQHYHRCSA-N |
|---|
| SMILES | C=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
|---|
Safety Information
Synonyms
| ethyl 7-hydroxycoumarin-3-carboxylate |
| 4-Vinylphenyl Beta-D-glucopyranoside |
| β-D-Glucopyranoside, 4-ethenylphenyl |
| 4-Hydroxysalicylaldehyde |
| Benzaldehyde,2,4-dihydroxy |
| resorcialdehyde |
| p-hydroxysalicylic aldehyde |
| 4-Formylresorcinol |
| 2,4-dihydroxy-benzaldehyde |
| 4-Vinylphenyl β-D-glucopyranoside |
