Introduction：Basic information about CAS 58123-66-3|3-Methanesulfonyl-5-nitrobenzoicacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methanesulfonyl-5-nitrobenzoicacid |
|---|
| CAS Number | 58123-66-3 | Molecular Weight | 245.20900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H7NO6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-(Methylsulfonyl)-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H7NO6S |
|---|
| Molecular Weight | 245.20900 |
|---|
| Exact Mass | 244.99900 |
|---|
| PSA | 125.64000 |
|---|
| LogP | 2.30050 |
|---|
| InChIKey | ZZNYBVMFYCWKIZ-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Methylsulfonyl-5-nitro-benzoic acid |
| 3-(methylsulfonyl)-5-nitroaniline |
| Benzenamine,3-(methylsulfonyl)-5-nitro |
| 5-nitro-3-methylsulfonylbenzoic acid |
| 3-nitro-5-(methylsufonyl)aniline |
