Introduction:Basic information about CAS 47128-12-1|2-[(4-Chlorophenyl)(1-methyl-4-piperidinylidene)methyl]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(4-Chlorophenyl)(1-methyl-4-piperidinylidene)methyl]pyridine |
|---|
| CAS Number | 47128-12-1 | Molecular Weight | 298.81000 |
|---|
| Density | 1.163g/cm3 | Boiling Point | 441.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19ClN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.6ºC |
|---|
Names
| Name | 2-[(4-Chlorophenyl)(1-methyl-4-piperidinylidene)methyl]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.163g/cm3 |
|---|
| Boiling Point | 441.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19ClN2 |
|---|
| Molecular Weight | 298.81000 |
|---|
| Flash Point | 220.6ºC |
|---|
| Exact Mass | 298.12400 |
|---|
| PSA | 16.13000 |
|---|
| LogP | 4.20040 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | HZNVLDCWAVIXRK-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCC(=C(c2ccc(Cl)cc2)c2ccccn2)CC1 |
|---|