Introduction：Basic information about CAS 652965-53-2|N'-hydroxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N'-hydroxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidamide |
|---|
| CAS Number | 652965-53-2 | Molecular Weight | 341.24200 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 450.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10F3N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.1ºC |
|---|
Names
| Name | N'-hydroxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidamide |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 450.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10F3N3O4 |
|---|
| Molecular Weight | 341.24200 |
|---|
| Flash Point | 226.1ºC |
|---|
| Exact Mass | 341.06200 |
|---|
| PSA | 113.66000 |
|---|
| LogP | 4.72390 |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | XMMAGODKMJZYPO-UHFFFAOYSA-N |
|---|
| SMILES | NC(=NO)c1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
|---|
