Introduction:Basic information about CAS 63559-21-7|dimethyl 5-hydroxy-3-methylbenzene-1,2-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 5-hydroxy-3-methylbenzene-1,2-dicarboxylate |
|---|
| CAS Number | 63559-21-7 | Molecular Weight | 224.21000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | dimethyl 5-hydroxy-3-methylbenzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H12O5 |
|---|
| Molecular Weight | 224.21000 |
|---|
| Exact Mass | 224.06800 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.27380 |
|---|
| InChIKey | HXTPLHDHJMZBKO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)cc(C)c1C(=O)OC |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Dimethyl 5-hydroxy-3-methylphthalate |
| 5-Hydroxy-3-methylphthalsaeure-dimethylester |
| dimethyl 4-hydroxy-6-methylphthalate |