Introduction：Basic information about CAS 78520-83-9|3-[[4-[(6,7-dichlorobenzothiazol-2-yl)azo]-3-methylphenyl]ethylamino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[[4-[(6,7-dichlorobenzothiazol-2-yl)azo]-3-methylphenyl]ethylamino]propiononitrile |
|---|
| CAS Number | 78520-83-9 | Molecular Weight | 418.34300 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 598.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17Cl2N5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.6ºC |
|---|
Names
| Name | 3-[2-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-3-methylphenyl]ethylamino]propanenitrile |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 598.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17Cl2N5S |
|---|
| Molecular Weight | 418.34300 |
|---|
| Flash Point | 315.6ºC |
|---|
| Exact Mass | 417.05800 |
|---|
| PSA | 101.67000 |
|---|
| LogP | 6.76358 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | CMEXZDOMJFDAOA-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCC#N)c1ccc(N=Nc2nc3ccc(Cl)c(Cl)c3s2)c(C)c1 |
|---|
