Introduction：Basic information about CAS 58470-74-9|1,3-dimethyl-5-[6-(phenylthio)benz[cd]indol-2(1H)-ylidene]barbituric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-dimethyl-5-[6-(phenylthio)benz[cd]indol-2(1H)-ylidene]barbituric acid |
|---|
| CAS Number | 58470-74-9 | Molecular Weight | 415.46400 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 594.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H17N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 313.1ºC |
|---|
Names
| Name | 1,3-dimethyl-5-(6-phenylsulfanyl-1H-benzo[cd]indol-2-ylidene)-1,3-diazinane-2,4,6-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 594.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H17N3O3S |
|---|
| Molecular Weight | 415.46400 |
|---|
| Flash Point | 313.1ºC |
|---|
| Exact Mass | 415.09900 |
|---|
| PSA | 98.78000 |
|---|
| LogP | 3.26810 |
|---|
| Index of Refraction | 1.781 |
|---|
| InChIKey | FPSFVDSMPKJDAK-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(O)c(C2=Nc3ccc(Sc4ccccc4)c4cccc2c34)c(=O)n(C)c1=O |
|---|
Synonyms
