Introduction:Basic information about CAS 4551-69-3|2-Pyrazolin-5-one, 4-benzoyl-3-methyl-1-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pyrazolin-5-one, 4-benzoyl-3-methyl-1-phenyl- |
|---|
| CAS Number | 4551-69-3 | Molecular Weight | 278.305 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 415.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H14N2O2 | Melting Point | 90-92 °C(lit.) |
|---|
| MSDS | / | Flash Point | 204.9±31.5 °C |
|---|
Names
| Name | 4-Benzoyl-3-Methyl-1-Phenyl-5-Pyrazolinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 415.2±55.0 °C at 760 mmHg |
|---|
| Melting Point | 90-92 °C(lit.) |
|---|
| Molecular Formula | C17H14N2O2 |
|---|
| Molecular Weight | 278.305 |
|---|
| Flash Point | 204.9±31.5 °C |
|---|
| Exact Mass | 278.105530 |
|---|
| PSA | 49.74000 |
|---|
| LogP | 3.10 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | JDOLPAMOKSAEMD-UHFFFAOYSA-N |
|---|
| SMILES | CC1=NN(c2ccccc2)C(=O)C1C(=O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-benzoyl-5-methyl-2-phenyl-4H-pyrazol-3-one |
| EINECS 224-918-8 |
| 2-Pyrazolin-5-one, 4-benzoyl-3-methyl-1-phenyl- |
| 3H-Pyrazol-3-one, 4-benzoyl-1,2-dihydro-5-methyl-2-phenyl- |
| 4-Benzoyl-5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one |
| 4-Benzoyl-5-methyl-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 4-Benzoyl-5-methyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| 4-Benzoyl-3-methyl-1-phenyl-5-pyrazolone |
| 1-Phenyl-3-methyl-4-benzoyl-2-pyrazolin-5-one |
| 3H-Pyrazol-3-one, 4-benzoyl-2,4-dihydro-5-methyl-2-phenyl- |
| 4-BENZOYL-3-METHYL-1-PHENYL-5-PYRAZOLINONE |
| 4-Benzoyl-3-methyl-1-phenyl-2-pyrazolin-5-one |
| MFCD00003136 |
| 4-Benzoyl-5-methyl-2-phenyl-1H-pyrazol-3(2H)-one |
| 1-phenyl-3-methyl-4-benzoylpyrazol-5-one |