Introduction：Basic information about CAS 182483-63-2|2-chloro-6-phenylmethoxypyridine-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-6-phenylmethoxypyridine-4-carboxylic acid |
|---|
| CAS Number | 182483-63-2 | Molecular Weight | 263.67600 |
|---|
| Density | 1.374g/cm3 | Boiling Point | 497.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.6ºC |
|---|
Names
| Name | 2-chloro-6-phenylmethoxypyridine-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.374g/cm3 |
|---|
| Boiling Point | 497.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClNO3 |
|---|
| Molecular Weight | 263.67600 |
|---|
| Flash Point | 254.6ºC |
|---|
| Exact Mass | 263.03500 |
|---|
| PSA | 59.42000 |
|---|
| LogP | 3.01220 |
|---|
| Vapour Pressure | 1.04E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | KMMINKCWBOCELM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Cl)nc(OCc2ccccc2)c1 |
|---|
Synonyms
| 2-chloro-6-benzyloxypyridine-4-carboxylic acid |
| 2-benzyloxy-6-chloro-isonicotinic acid |
