Introduction:Basic information about CAS 97-29-0|Resorcinol sulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Resorcinol sulfide |
|---|
| CAS Number | 97-29-0 | Molecular Weight | 250.27000 |
|---|
| Density | 1.63g/cm3 | Boiling Point | 532.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H10O4S | Melting Point | 173-177 °C |
|---|
| MSDS | / | Flash Point | 258ºC |
|---|
Names
| Name | 4-(2,4-dihydroxyphenyl)sulfanylbenzene-1,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.63g/cm3 |
|---|
| Boiling Point | 532.4ºC at 760mmHg |
|---|
| Melting Point | 173-177 °C |
|---|
| Molecular Formula | C12H10O4S |
|---|
| Molecular Weight | 250.27000 |
|---|
| Flash Point | 258ºC |
|---|
| Exact Mass | 250.03000 |
|---|
| PSA | 106.22000 |
|---|
| LogP | 2.66020 |
|---|
| Index of Refraction | 1.804 |
|---|
| InChIKey | WEMYXYMZQRSPIA-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(Sc2ccc(O)cc2O)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25-S36-S26 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4,4'-Thiobis(resorcinol) |
| 2,4,2',4'-tetrahydroxydiphenyl sulfide |
| 2,4-Dihydroxyphenyl sulfide |
| 4,4'-sulfanediyl-di-resorcinol |
| 1,3-Benzenediol,4,4'-thiobis |
| 4,4'-Thiodiresorcinol |
| Bis-(2.4-dihydroxy-phenyl)-sulfid |
| bis(2,4-dihydroxoybenzo)sulphide |
| 4,4'-Diresorcyl sulfide |
| 2,2',4,4'-Tetrahydroxydiphenyl sulfide |
| Bis(2,4-dihydroxyphenyl) sulfide |
| MFCD00045769 |
| 4,4'-Sulfandiyl-di-resorcin |
| EINECS 202-570-8 |