Introduction：Basic information about CAS 716-03-0|6-Fluoro-2-methyl-4-quinoline carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Fluoro-2-methyl-4-quinoline carboxylic acid |
|---|
| CAS Number | 716-03-0 | Molecular Weight | 205.18500 |
|---|
| Density | 1.369g/cm3 | Boiling Point | 348ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8FNO2 | Melting Point | 250ºC |
|---|
| MSDS | USA | Flash Point | 164.3ºC |
|---|
Names
| Name | 6-fluoro-2-methylquinoline-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.369g/cm3 |
|---|
| Boiling Point | 348ºC at 760 mmHg |
|---|
| Melting Point | 250ºC |
|---|
| Molecular Formula | C11H8FNO2 |
|---|
| Molecular Weight | 205.18500 |
|---|
| Flash Point | 164.3ºC |
|---|
| Exact Mass | 205.05400 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 2.38050 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | KXMSETXWKPJCQS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)O)c2cc(F)ccc2n1 |
|---|
Safety Information
Synonyms
| 6-Fluoro-2-methyl-quinoline-4-carboxylic acid |
| 6-fluoro-2-methyl-4-quinolinecarboxylic acid |
| 6-Fluor-2-methyl-chinolin-4-carbonsaeure |
