Introduction：Basic information about CAS 34732-09-7|2,3,4-Trichlorobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4-Trichlorobenzenesulfonyl chloride |
|---|
| CAS Number | 34732-09-7 | Molecular Weight | 279.956 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 349.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H2Cl4O2S | Melting Point | 63-65°C |
|---|
| MSDS | ChineseUSA | Flash Point | 165.4±27.9 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2,3,4-trichlorobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 349.9±42.0 °C at 760 mmHg |
|---|
| Melting Point | 63-65°C |
|---|
| Molecular Formula | C6H2Cl4O2S |
|---|
| Molecular Weight | 279.956 |
|---|
| Flash Point | 165.4±27.9 °C |
|---|
| Exact Mass | 277.852966 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.92 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | JDAJYNHGBUXIKS-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(Cl)c(Cl)c1Cl |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S27-S36/37/39-S45-S30-S23-S22-S28 |
|---|
| RIDADR | 1759 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 252-174-4 |
| Benzenesulfonyl chloride, 2,3,4-trichloro- |
| 2,3,4-trichlorobenzene-1-sulfonyl chloride |
| 2,3,4-Trichlorobenzenesulfonyl chloride |
| MFCD00024871 |
| 2,3,4-trichlorobenzenesulfonylchloride |
| 2,3,4-trichlorophenylsulfonyl chloride |
| Benzenesulfonyl chloride,2,3,4-trichloro |
| 2,3,4-Trichlor-benzolsulfonylchlorid |
| 2,3,4-trichlorobenzenesulphonylchloride |
| 2,3,4,5,6-PENTACHLOROPHENYL 2,4-DICHLOROBENZOATE |
