Introduction：Basic information about CAS 927679-54-7|(1R,5S)-3-tert-butoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,5S)-3-tert-butoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
|---|
| CAS Number | 927679-54-7 | Molecular Weight | 227.257 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.0±25.9 °C |
|---|
Names
| Name | (1R,5S,6r)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 355.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO4 |
|---|
| Molecular Weight | 227.257 |
|---|
| Flash Point | 169.0±25.9 °C |
|---|
| Exact Mass | 227.115753 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 0.33 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | GYEQQDCMLKKYGG-DHBOJHSNSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C2C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| (1R,5S)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| (1R,5S,6r)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| (1R,5S)-3-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| 3-Azabicyclo[3.1.0]hexane-3,6-dicarboxylic acid, 3-(1,1-dimethylethyl) ester, (1R,5S)- |
| (1R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
