Introduction：Basic information about CAS 92-40-0|2-Naphthalenesulfonic acid, 7-hydroxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Naphthalenesulfonic acid, 7-hydroxy- |
|---|
| CAS Number | 92-40-0 | Molecular Weight | 224.23300 |
|---|
| Density | 1.549g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H8O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 7-hydroxynaphthalene-2-sulphonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.549g/cm3 |
|---|
| Molecular Formula | C10H8O4S |
|---|
| Molecular Weight | 224.23300 |
|---|
| Exact Mass | 224.01400 |
|---|
| PSA | 82.98000 |
|---|
| LogP | 2.87290 |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | MVEOHWRUBFWKJY-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc2ccc(O)cc2c1 |
|---|
Safety Information
| RIDADR | UN 1759 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 7-hydroxy-2-naphthosulfonic acid |
| 2-Hydroxy-7-naphthalenesulfonic acid |
| 2-Hydroxynaphthalene-7-sulfonicacid |
| 2-naphthol-7-sulfonic acid |
| 7-Hydroxy-naphthalin-2-sulfonsaeure |
| 7-hydroxy-naphthalene-2-sulfonic acid |
