Introduction：Basic information about CAS 92-89-7|4'-Nitro-4-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Nitro-4-biphenylcarboxylic acid |
|---|
| CAS Number | 92-89-7 | Molecular Weight | 243.215 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 450.2±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9NO4 | Melting Point | 350ºC |
|---|
| MSDS | / | Flash Point | 194.2±12.5 °C |
|---|
Names
| Name | 4-(4-nitrophenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 450.2±28.0 °C at 760 mmHg |
|---|
| Melting Point | 350ºC |
|---|
| Molecular Formula | C13H9NO4 |
|---|
| Molecular Weight | 243.215 |
|---|
| Flash Point | 194.2±12.5 °C |
|---|
| Exact Mass | 243.053162 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.37 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | LYINHPAEAYJDIR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-carboxy-4'-nitrobiphenyl |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-nitro- |
| 4-Nitro-4'-biphenylcarboxylic acid |
| 4'-Nitrobiphenyl-4-carboxylic acid |
| 4'-Nitrodiphenyl-4-carboxylic acid |
| 4'-Nitro-biphenyl-4-carbonsaeure |
| 4'-Nitro-4-biphenylcarboxylic acid |
| 4'-Nitro-biphenyl-4-carboxylic acid |
