Introduction：Basic information about CAS 58578-45-3|2H-1-BENZOPYRAN-3-AMINE,3,4-DIHYDRO-8-METHOXY-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2H-1-BENZOPYRAN-3-AMINE,3,4-DIHYDRO-8-METHOXY- |
|---|
| CAS Number | 58578-45-3 | Molecular Weight | 341.35800 |
|---|
| Density | 1.223 | Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19NO5 | Melting Point | 80.5-82ºC |
|---|
| MSDS | / | Flash Point | 276.8ºC |
|---|
Names
| Name | benzyl (2S)-4-oxo-2-(phenylmethoxycarbonylamino)butanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.223 |
|---|
| Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Melting Point | 80.5-82ºC |
|---|
| Molecular Formula | C19H19NO5 |
|---|
| Molecular Weight | 341.35800 |
|---|
| Flash Point | 276.8ºC |
|---|
| Exact Mass | 341.12600 |
|---|
| PSA | 81.70000 |
|---|
| LogP | 3.00470 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | DXBNGOWOMMHJKK-KRWDZBQOSA-N |
|---|
| SMILES | O=CCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|---|
Synonyms
| Cbz-Asp(CHO)-OBzl |
| N-benzyloxycarbonyl-L-aspartic semi-aldehyde benzyl ester |
| (2S)-2-(benzyloxycarbonylamino)-4-oxobutyric acid benzyl ester |
| benzyl (2S)-2-(benzyloxycarbonyl)amino-3-formyl propionate |
| (S)-benzyl 2-(((benzyloxy)carbonyl)amino)-4-oxobutanoate |
| benzyl 4-oxo-2-(s)-[[(phenylmethoxy)carbonyl]amino]butanoate |
