Introduction：Basic information about CAS 18880-36-9|DPS, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DPS |
|---|
| CAS Number | 18880-36-9 | Molecular Weight | 265.349 |
|---|
| Density | / | Boiling Point | 245.5ºC at 760 mmHg |
|---|
| Molecular Formula | C6H12NNaO3S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 102.3ºC |
|---|
Names
| Name | sodium,3-(dimethylcarbamothioylsulfanyl)propane-1-sulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 245.5ºC at 760 mmHg |
|---|
| Molecular Formula | C6H12NNaO3S3 |
|---|
| Molecular Weight | 265.349 |
|---|
| Flash Point | 102.3ºC |
|---|
| Exact Mass | 264.987701 |
|---|
| PSA | 126.21000 |
|---|
| LogP | 1.58220 |
|---|
| Vapour Pressure | 0.0286mmHg at 25°C |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | ALXDAYUOWUEKLS-UHFFFAOYSA-M |
|---|
| SMILES | CN(C)C(=S)SCCCS(=O)(=O)[O-].[Na+] |
|---|
Synonyms
| 1-Propanesulfonic acid, 3-[[(dimethylamino)thioxomethyl]thio]-, sodium salt (1:1) |
| MFCD00801050 |
| N,N-dimethyl-dithiocarbamylpropyl sulfonic acid sodium salt |
| sodium 3-[(dimethylcarbamothioyl)sulfanyl]propane-1-sulfonate |
| Sodium 3-(((dimethylamino)thioxomethyl)thio)propanesulphonate |
| EINECS 242-644-7 |
| 1-Propanesulfonic acid,3-(((dimethylamino)thioxomethyl)thio)-,sodium salt |
| Sodium 3-[(dimethylcarbamothioyl)sulfanyl]-1-propanesulfonate |
| 3-Sulfopropyl N,N-dimethyldithiocarbamate,sodium salt |
| DPS |
