Introduction：Basic information about CAS 5804-73-9|5-Acetylamino-2-methoxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Acetylamino-2-methoxybenzenesulfonyl chloride |
|---|
| CAS Number | 5804-73-9 | Molecular Weight | 263.69800 |
|---|
| Density | 1.439 g/cm3 | Boiling Point | 477.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.4ºC |
|---|
Names
| Name | 5-acetamido-2-methoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.439 g/cm3 |
|---|
| Boiling Point | 477.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO4S |
|---|
| Molecular Weight | 263.69800 |
|---|
| Flash Point | 242.4ºC |
|---|
| Exact Mass | 263.00200 |
|---|
| PSA | 80.85000 |
|---|
| LogP | 2.73490 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | VWKRNDWDKNOMAD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(NC(C)=O)cc1S(=O)(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Methoxy-5-acetamido-benzolsulfonsaeurechlorid |
| 5-acetamido-2-methoxybenzene-1-sulfonyl chloride |
| 2-methoxy-5-acetylaminobenzenesulfonyl chloride |
| Benzenesulfonyl chloride,5-acetamido-2-methoxy |
| 5-Acetylamino-2-methoxy-benzenesulfonyl chloride |
| 5-Acetamino-2-methoxy-benzolsulfonyl |
| 5-Acetamido-2-methoxybenzenesulphonyl chloride |
| 5-Acetamino-2-methoxy-benzolsulfonylchlorid |
