Introduction：Basic information about CAS 3406-03-9|2-(phenylsulfonyl)acetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(phenylsulfonyl)acetophenone |
|---|
| CAS Number | 3406-03-9 | Molecular Weight | 260.30800 |
|---|
| Density | 1.256g/cm3 | Boiling Point | 472ºC at 760mmHg |
|---|
| Molecular Formula | C14H12O3S | Melting Point | 93-95 °C(lit.) |
|---|
| MSDS | / | Flash Point | 305ºC |
|---|
Names
| Name | 2-(benzenesulfonyl)-1-phenylethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256g/cm3 |
|---|
| Boiling Point | 472ºC at 760mmHg |
|---|
| Melting Point | 93-95 °C(lit.) |
|---|
| Molecular Formula | C14H12O3S |
|---|
| Molecular Weight | 260.30800 |
|---|
| Flash Point | 305ºC |
|---|
| Exact Mass | 260.05100 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 3.42400 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | DREVPGKOIZVPQV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CS(=O)(=O)c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 222-292-0 |
| Acetophenone,2-(phenylsulfonyl) |
| MFCD00025043 |
| Ethanone,1-phenyl-2-(phenylsulfonyl) |
| 1-Phenyl-2-(phenylsulfonyl)ethanone |
| 2-Benzenesulfonylacetophenone |
| 2-(PHENYLSULFONYL)ACETOPHENONE |
| 2-Phenylsulfonylacetophenone |
| 1-phenyl-2-(phenylsulfonyl)ethan-1-one |
