Introduction：Basic information about CAS 65032-66-8|2-(2-methyl-1,3-thiazol-4-yl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-methyl-1,3-thiazol-4-yl)benzoic acid |
|---|
| CAS Number | 65032-66-8 | Molecular Weight | 219.26000 |
|---|
| Density | 1.319 | Boiling Point | 380ºC |
|---|
| Molecular Formula | C11H9NO2S | Melting Point | 145.5-146.5ºC |
|---|
| MSDS | USA | Flash Point | 183ºC |
|---|
Names
| Name | 2-(2-methyl-1,3-thiazol-4-yl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319 |
|---|
| Boiling Point | 380ºC |
|---|
| Melting Point | 145.5-146.5ºC |
|---|
| Molecular Formula | C11H9NO2S |
|---|
| Molecular Weight | 219.26000 |
|---|
| Flash Point | 183ºC |
|---|
| Exact Mass | 219.03500 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 2.81670 |
|---|
| InChIKey | BNRSCIXYHUTATP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccccc2C(=O)O)cs1 |
|---|
Safety Information
| Risk Phrases | 22-36/37/38 |
|---|
| Safety Phrases | 22-26-36/37/39 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| Benzoic acid,2-(2-methyl-4-thiazolyl) |
| 2-(1-HYDRAZONO-3-PHENYL-ALLYL)-PHENOL |
| 2-(2-Methyl-thiazol-4-yl)-benzoesaeure |
| 4-(2-Carboxyphenyl)-2-methyl-1,3-thiazole |
| 2-(2-methyl-thiazol-4-yl)-benzoic acid |
