Introduction：Basic information about CAS 71351-01-4|2,2-diphenylethanesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-diphenylethanesulfonyl chloride |
|---|
| CAS Number | 71351-01-4 | Molecular Weight | 280.77000 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 383.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13ClO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.9ºC |
|---|
Names
| Name | 2,2-diphenylethanesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 383.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13ClO2S |
|---|
| Molecular Weight | 280.77000 |
|---|
| Flash Point | 185.9ºC |
|---|
| Exact Mass | 280.03200 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.46790 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | DYESDWUOAPVIIV-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)CC(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| 2,2-diphenylethanesulfonylchloride |
| AR3521 |
| 2,2-DIMETHYL-5-(4-METHYLBENZYL)-1,3-DIOXANE-4,6-DIONE |
| Benzhydrylmethylsulphonyl chloride |
| DES-0-0 |
