Introduction：Basic information about CAS 586-91-4|4,4'-azobisbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-azobisbenzoic acid |
|---|
| CAS Number | 586-91-4 | Molecular Weight | 270.24000 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 541.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.1ºC |
|---|
Names
| Name | Azobenzene-4,4'-dicarboxylic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 541.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H10N2O4 |
|---|
| Molecular Weight | 270.24000 |
|---|
| Flash Point | 281.1ºC |
|---|
| Exact Mass | 270.06400 |
|---|
| PSA | 99.32000 |
|---|
| LogP | 3.49840 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | NWHZQELJCLSKNV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(N=Nc2ccc(C(=O)O)cc2)cc1 |
|---|
Synonyms
| EINECS 209-589-0 |
| 4-[(4-carboxyphenyl)diazenyl]benzoic acid |
