Introduction:Basic information about CAS 49690-09-7|N-tert-Butyl 4-Nitrophenylsulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-tert-Butyl 4-Nitrophenylsulfonamide |
|---|
| CAS Number | 49690-09-7 | Molecular Weight | 258.29400 |
|---|
| Density | 1.282g/cm3 | Boiling Point | 392.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191ºC |
|---|
Names
| Name | N-tert-Butyl 4-Nitrophenylsulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.282g/cm3 |
|---|
| Boiling Point | 392.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O4S |
|---|
| Molecular Weight | 258.29400 |
|---|
| Flash Point | 191ºC |
|---|
| Exact Mass | 258.06700 |
|---|
| PSA | 100.37000 |
|---|
| LogP | 3.66650 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | YVSUQTZCHSBFEN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Benzenesulfonic acid,4-nitro-,2-(1-methylpropylidene)hydrazide |
| N-(BUTAN-2-YLIDENEAMINO)-4-NITRO-BENZENESULFONAMIDE |
| N-tert-butyl-4-nitrobenzenesulfonamide |
| 4-Nitro-benzolsulfonsaeure-tert-butylamid |
| 4-nitro-benzenesulfonic acid tert-butylamide |
| N-tert-Butyl4-Nitrophenylsulfonamide |
| Benzenesulfonicacid,4-nitro-,(1-methylpropylidene)hydrazide (9CI) |
| 4-Nitro-benzolsulfonsaeure-sec-butylidenhydrazid |
| 4-nitro-benzenesulfonic acid sec-butylidenehydrazide |
| 2-Butanone p-nitrophenylsulfonylhydrazone |