Introduction：Basic information about CAS 633327-51-2|6-Fluoro-5-nitro-1H-indazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Fluoro-5-nitro-1H-indazole |
|---|
| CAS Number | 633327-51-2 | Molecular Weight | 181.124 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 401.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4FN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.4±23.2 °C |
|---|
Names
| Name | 6-fluoro-5-nitro-1H-indazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 401.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4FN3O2 |
|---|
| Molecular Weight | 181.124 |
|---|
| Flash Point | 196.4±23.2 °C |
|---|
| Exact Mass | 181.028748 |
|---|
| PSA | 74.50000 |
|---|
| LogP | 1.77 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.704 |
|---|
| InChIKey | CQWPKRSNPVUHQA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc2cn[nH]c2cc1F |
|---|
Synonyms
| 1H-Indazole, 6-fluoro-5-nitro- |
| 6-Fluoro-5-nitroindazole |
| 6-Fluoro-5-nitro-1H-indazole |
| 5-nitro-6-fluoro-1H-indazole |
| PC5531 |
