Introduction:Basic information about CAS 62595-02-2|2-Chloro-3-(2-chloroethyl)-6-methylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(2-chloroethyl)-6-methylquinoline |
|---|
| CAS Number | 62595-02-2 | Molecular Weight | 240.12800 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 363.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.1ºC |
|---|
Names
| Name | 2-Chloro-3-(2-chloroethyl)-6-methylquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 363.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl2N |
|---|
| Molecular Weight | 240.12800 |
|---|
| Flash Point | 205.1ºC |
|---|
| Exact Mass | 239.02700 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 3.97790 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | GFPYKOMHMFVDEE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2nc(Cl)c(CCCl)cc2c1 |
|---|
Synonyms
| Quinoline,2-chloro-3-(2-chloroethyl)-6-methyl |
| 2-chloro-3-(2-chloro-ethyl)-6-methyl-quinoline |
| 2-Chlor-3-(2-chlorethyl)-6-methylchinolin |